
Catalog Number	AR0035PU
Chemical Name	3-Indolebutyric acid
CAS Number	133-32-4
Molecular Formula	C12H13NO2
Molecular Weight	203.2371
MDL Number	MFCD00005664
SMILES	OC(=O)CCCc1c[nH]c2c1cccc2
NSC Number	3130

3-Indolebutyric acid is a versatile compound widely used in chemical synthesis due to its unique properties. One key application of 3-Indolebutyric acid is its use as a plant growth hormone, promoting root development and enhancing overall plant growth. In addition to its role in plant biology, this compound is also utilized in the synthesis of pharmaceuticals, specifically in the production of anti-inflammatory and anti-cancer medications. Furthermore, 3-Indolebutyric acid serves as a valuable intermediate in the creation of various organic compounds, such as indole derivatives and peptide analogs, making it a crucial building block in organic chemistry research and development.