
Catalog Number	AR01K88M
Chemical Name	4-(4-Aminomethyl-benzoyl)-piperazine-1-carboxylic acid tert-butyl ester
CAS Number	1299397-08-2
Molecular Formula	C17H25N3O3
Molecular Weight	319.3987
MDL Number	MFCD33395921
SMILES	NCc1ccc(cc1)C(=O)N1CCN(CC1)C(=O)OC(C)(C)C

4-(4-Aminomethyl-benzoyl)-piperazine-1-carboxylic acid tert-butyl ester is a versatile compound commonly used in chemical synthesis due to its unique structural properties. Its application in organic chemistry primarily revolves around its role as a building block or intermediate in the synthesis of various pharmaceuticals and complex organic molecules. This compound serves as a valuable precursor in the development of novel drug candidates and bioactive compounds. Its specific chemical reactivity allows for selective functional group manipulations, making it an indispensable tool for organic chemists in designing and synthesizing diverse molecular structures. Furthermore, the tert-butyl ester moiety provides stability to the molecule during synthetic transformations, allowing for efficient and controlled reactions. The strategic incorporation of 4-(4-Aminomethyl-benzoyl)-piperazine-1-carboxylic acid tert-butyl ester in chemical synthesis enables the efficient construction of intricate molecular frameworks essential for drug discovery and synthetic chemistry research.