
Catalog Number	AR000LMD
Chemical Name	2(3H)-Benzoxazolone, 5-[(2-chloro-5-methyl-4-pyrimidinyl)amino]-
CAS Number	1236670-87-3
Molecular Formula	C12H9ClN4O2
Molecular Weight	276.6785
MDL Number	MFCD26940351
SMILES	Clc1ncc(c(n1)Nc1ccc2c(c1)[nH]c(=O)o2)C

5-((2-chloro-5-methylpyrimidin-4-yl)amino)benzo[d]oxazol-2(3H)-one is a versatile compound widely used in chemical synthesis for its unique properties. This compound serves as a valuable building block in the synthesis of various pharmaceuticals, agrochemicals, and materials due to its functional groups and structural versatility. Its ability to undergo various chemical transformations makes it an important intermediate in the production of biologically active molecules and complex organic compounds. In addition, the presence of the chloro-substituted pyrimidine ring and the oxazolone moiety confers specific reactivity and selectivity in synthetic reactions, making it a valuable tool for organic chemists in designing and developing novel chemical entities.