
Catalog Number	AR007UO7
Chemical Name	Boronic acid, 2-thianthrenyl-
CAS Number	108847-21-8
Molecular Formula	C12H9BO2S2
Molecular Weight	260.13966
MDL Number	MFCD06801664
SMILES	OB(c1ccc2c(c1)Sc1c(S2)cccc1)O

$name$ is a versatile and valuable compound in chemical synthesis due to its unique properties in cross-coupling reactions. This boronic acid derivative serves as a key building block in the construction of organic molecules, particularly in the formation of carbon-carbon bonds. Its incorporation in various synthetic pathways enables the creation of complex molecular structures with high precision and efficiency. Moreover, the B-2-thianthrenyl- functionality enhances the reactivity and selectivity of the reaction, making it a preferred reagent in advanced chemical transformations. Its broad applicability in medicinal chemistry, materials science, and agrochemicals highlights its significance as a powerful tool in modern synthetic methodologies.

Boronic acid, 2-thianthrenyl-

108847-21-8

Product Details