
Catalog Number	AR00HBFR
Chemical Name	Carbamic acid, 1H-benzimidazol-2-yl-, methyl ester
CAS Number	10605-21-7
Molecular Formula	C9H9N3O2
Molecular Weight	191.1867
MDL Number	MFCD00055390
SMILES	COC(=O)Nc1nc2c([nH]1)cccc2

Methyl 1H-benzo[d]imidazol-2-ylcarbamate, also known as $name$, is a versatile compound widely utilized in chemical synthesis. This compound plays a crucial role in organic chemistry as a key building block for the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. In the realm of chemical synthesis, $name$ serves as a valuable intermediate in the production of bioactive compounds and complex molecules. Its unique structure and reactivity make it a valuable tool for constructing diverse molecular frameworks. $name$ can participate in various reactions such as nucleophilic substitutions, cycloadditions, and condensations, enabling the formation of complex chemical structures with high efficiency.Moreover, the presence of the imidazole ring in $name$ imparts distinct properties to the synthesized products, making them potential candidates for biological applications. The versatility of $name$ in chemical synthesis positions it as a valuable asset in the development of novel compounds with therapeutic, agricultural, or industrial significance.