
Catalog Number	AR01K7W8
Chemical Name	5-Nitro-3-(trifluoromethyl)-1H-Indole
CAS Number	1049026-43-8
Molecular Formula	C9H5F3N2O2
Molecular Weight	230.1434
SMILES	FC(C1=CNC2=C1C=C([N+]([O-])=O)C=C2)(F)F

5-Nitro-3-(trifluoromethyl)-1H-Indole is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. In organic synthesis, it serves as a powerful building block for the construction of complex molecules, particularly in medicinal chemistry and material science. The nitro and trifluoromethyl groups on the indole ring can participate in a variety of reactions, such as nucleophilic substitution, reduction, and cyclization, allowing for the efficient and selective formation of intricate chemical structures. This compound is particularly valuable in the design and synthesis of pharmaceuticals, agrochemicals, and advanced materials, where its specific functionalities can be harnessed to introduce desired properties and functionalities. Moreover, the presence of the nitro group enables further derivatization through a range of chemistries, expanding the scope of its applications in diverse synthetic processes.