
Catalog Number	AR01FQE5
Chemical Name	(2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)(morpholino)methanone
CAS Number	1013643-15-6
Molecular Formula	C18H26BNO4
Molecular Weight	331.2143
MDL Number	MFCD26398862
SMILES	Cc1cc(ccc1C(=O)N1CCOCC1)B1OC(C(O1)(C)C)(C)C

The compound (2-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)(morpholino)methanone is a versatile building block in chemical synthesis. It is commonly used as a precursor in the preparation of novel organic compounds due to its unique structural features and reactivity.One of the key applications of this compound is in transition metal-catalyzed cross-coupling reactions, particularly in Suzuki-Miyaura coupling. By utilizing the boron functionality as a site for bond formation, this compound can be coupled with various aryl or alkyl halides to construct complex molecular architectures. This method provides a powerful tool for the synthesis of pharmaceuticals, agrochemicals, and materials with tailored properties.Furthermore, the morpholino moiety in the compound can serve as a protecting group for amines or as a directing group in C-H activation reactions. Through selective removal or functionalization of the morpholino group, further elaboration of the molecular scaffold can be achieved, allowing for the generation of diverse chemical libraries for drug discovery or material design.Overall, the compound (2-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)(morpholino)methanone plays a crucial role in enabling efficient and selective transformations in organic synthesis, facilitating the creation of complex molecules with potential biological or technological relevance.