
Catalog Number	AR01FOLJ
Chemical Name	(4-(pentan-3-ylcarbamoyl)phenyl)boronic acid
CAS Number	956894-13-6
Molecular Formula	C12H18BNO3
Molecular Weight	235.0872
MDL Number	MFCD31700571
SMILES	CCC(NC(=O)c1ccc(cc1)B(O)O)CC

The (4-(pentan-3-ylcarbamoyl)phenyl)boronic acid is a versatile compound commonly utilized in chemical synthesis as a key building block in organic chemistry. Its unique structure containing both a boronic acid group and a carbamoyl group makes it a valuable reagent in various synthetic processes.One of the primary applications of this compound is in Suzuki-Miyaura cross-coupling reactions, where it serves as a boronate ester precursor. By reacting with suitable aryl halides or pseudohalides in the presence of a palladium catalyst, the (4-(pentan-3-ylcarbamoyl)phenyl)boronic acid can be utilized to form biaryl compounds efficiently. This reaction is widely used in the synthesis of pharmaceuticals, agrochemicals, and materials science.Additionally, the boronic acid functionality in this compound can undergo further transformations, such as oxidation to form boronic acid pinacol esters or reduction to yield boronates. These derivatives can participate in various chemical transformations, including C-C bond formations, C-N bond formations, and complex molecule syntheses.Overall, the (4-(pentan-3-ylcarbamoyl)phenyl)boronic acid is a valuable and versatile tool in organic synthesis, enabling chemists to access a diverse array of complex molecules with potential applications in various industries.