
Catalog Number	AR01EIML
Chemical Name	1-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrrole
CAS Number	949115-04-2
Molecular Formula	C16H20BNO2
Molecular Weight	269.1465
MDL Number	MFCD22415357
SMILES	CC1(C)OB(OC1(C)C)c1ccc(cc1)n1cccc1

1H-Pyrrole, 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]- is a versatile compound that finds valuable application in chemical synthesis procedures. This compound serves as a key building block for the creation of various organic molecules through Suzuki-Miyaura cross-coupling reactions. By incorporating this specific 1H-pyrrole derivative, chemists can efficiently introduce the phenyl moiety while taking advantage of the unique reactivity of the boron moiety. This enables the synthesis of diverse compounds with enhanced structural complexity and functionality, making it a vital tool in the toolkit of synthetic chemists aiming to access novel molecular architectures.