
Catalog Number	AR006GN2
Chemical Name	Venlafaxine
CAS Number	93413-69-5
Molecular Formula	C17H27NO2
Molecular Weight	277.4018
MDL Number	MFCD00864385
SMILES	COc1ccc(cc1)C(C1(O)CCCCC1)CN(C)C
NSC Number	758676

The compound 1-[2-(Dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexanol, known by the chemical name $name$, is a versatile building block used in chemical synthesis. Its unique structure and functional groups make it a valuable reagent in organic chemistry. In chemical synthesis, this compound serves as a key intermediate for the preparation of various pharmaceuticals, agrochemicals, and fine chemicals. Its cyclohexanol backbone provides a stable and versatile scaffold for the introduction of additional functional groups, allowing for the creation of complex molecular structures. Additionally, the presence of the dimethylamino and methoxyphenyl groups offers opportunities for selective derivatization and modification, leading to the synthesis of diverse compounds with tailored properties. Overall, the application of 1-[2-(Dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexanol in chemical synthesis enables the efficient and strategic construction of advanced chemical compounds with potential applications in various industries.