
Catalog Number	AR01KGJP
Chemical Name	5-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-methyl-1H-pyrazole-4-carboxylic acid
CAS Number	916850-80-1
Molecular Formula	C10H15N3O4
Molecular Weight	241.2438
MDL Number	MFCD16875652
SMILES	O=C(Nc1n(C)ncc1C(=O)O)OC(C)(C)C

In chemical synthesis, 1H-Pyrazole-4-carboxylic acid, 5-[(1,1-dimethylethoxy)carbonyl]amino]-1-methyl- can be utilized as a versatile building block for the creation of various organic compounds. This compound offers a valuable functional group that can participate in a range of reactions, including amidation, esterification, and condensation reactions. Its unique structure and reactivity make it a valuable tool in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. With careful manipulation and strategic design, this compound can be harnessed to introduce specific functionalities into target molecules, allowing for the controlled synthesis of complex organic compounds.