
Catalog Number	AR00GSHS
Chemical Name	Fluxapyroxad
CAS Number	907204-31-3
Molecular Formula	C18H12F5N3O
Molecular Weight	381.2994
MDL Number	MFCD22373628
SMILES	Cn1nc(c(c1)C(=O)Nc1ccccc1c1cc(F)c(c(c1)F)F)C(F)F

1H-Pyrazole-4-carboxamide, 3-(difluoromethyl)-1-methyl-N-(3',4',5'-trifluoro[1,1'-biphenyl]-2-yl) is a versatile compound widely used in chemical synthesis as a key building block for the creation of novel pharmaceuticals, agrochemicals, and materials. It exhibits unique reactivity due to the presence of the pyrazole ring, difluoromethyl, and trifluorobiphenyl moieties, making it valuable in the development of molecular scaffolds with specific biological activities. Its ability to participate in diverse chemical reactions opens up opportunities for the design and synthesis of structurally complex molecules with desired properties. Its integration into a variety of synthetic routes enables the generation of structurally diverse compounds for applications in drug discovery, material science, and other fields.