
Catalog Number	AR00GRXR
Chemical Name	Azilsartan Medoxomil
CAS Number	863031-21-4
Molecular Formula	C30H24N4O8
Molecular Weight	568.5336
MDL Number	MFCD19443688
SMILES	CCOc1nc2c(n1Cc1ccc(cc1)c1ccccc1c1noc(=O)[nH]1)c(ccc2)C(=O)OCc1oc(=O)oc1C

Azilsartan medoxomil, a member of the angiotensin II receptor antagonist class of drugs, finds significant application in chemical synthesis as a key intermediate in the manufacturing of pharmaceutical products. The compound's unique chemical structure and properties make it a versatile building block in the synthesis of various drug molecules, particularly those targeted at cardiovascular and renal diseases. Azilsartan medoxomil is utilized in the synthesis of novel angiotensin II receptor antagonists and related pharmaceutical derivatives that possess improved pharmacokinetic profiles and therapeutic efficacy. Additionally, its role in chemical synthesis extends to the development of potential drug candidates aimed at treating hypertension, heart failure, and other related medical conditions. The efficient incorporation of Azilsartan medoxomil into synthetic routes underscores its importance as a valuable tool in medicinal chemistry research and drug discovery endeavors.