
Catalog Number	AR004T79
Chemical Name	2-Borono-5-chlorobenzoic acid
CAS Number	850568-07-9
Molecular Formula	C7H6BClO4
Molecular Weight	200.3841
MDL Number	MFCD06659869
SMILES	Clc1ccc(c(c1)C(=O)O)B(O)O

Benzoic acid, 2-borono-5-chloro- is a versatile chemical compound that is commonly used in chemical synthesis as a key building block. This compound plays a crucial role in the formation of various advanced organic molecules due to its unique structure and reactivity. In organic synthesis, it serves as a valuable reagent for the introduction of boron functionality into complex molecules, enabling the synthesis of diverse pharmaceuticals, agrochemicals, and materials. Additionally, Benzoic acid, 2-borono-5-chloro- has been utilized in the development of novel catalysts and ligands for catalytic reactions, offering a wide range of applications in the field of organometallic chemistry. Its ability to participate in cross-coupling reactions and other transformations makes it an indispensable tool for synthetic chemists seeking to access new and innovative molecular architectures.