
Catalog Number	AR00G9BN
Chemical Name	N-[4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]CYCLOPENTANECARBOXAMIDE
CAS Number	799293-93-9
Molecular Formula	C18H26BNO3
Molecular Weight	315.2149
MDL Number	MFCD22415456
SMILES	O=C(C1CCCC1)Nc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopentanecarboxamide is a valuable compound widely utilized in chemical synthesis due to its unique reactivity and functional group compatibility. Specifically, this compound serves as a versatile building block in various organic reactions, such as Suzuki-Miyaura coupling, palladium-catalyzed cross-coupling, and metal-catalyzed carbon-carbon bond formation. Its cyclopentanecarboxamide moiety provides structural diversity and stability, making it an essential component in the construction of complex molecules and pharmaceutical intermediates. By incorporating N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopentanecarboxamide into synthetic schemes, chemists can efficiently access novel compounds with diverse pharmacological, material science, and agrochemical applications.