
Catalog Number	AR005D1G
Chemical Name	7-ETHOXY-2-OXO-2H-CHROMENE-3-CARBOXYLIC ACID
CAS Number	79065-74-0
Molecular Formula	C12H10O5
Molecular Weight	234.2048
MDL Number	MFCD08691745
SMILES	CCOc1ccc2c(c1)oc(=O)c(c2)C(=O)O

7-Ethoxy-2-oxo-2H-chromene-3-carboxylic acid is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. This compound serves as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and other organic compounds. In particular, it is commonly employed in the preparation of heterocyclic compounds, which are essential in drug discovery and development. Its functional groups enable it to participate in a wide range of chemical reactions, leading to the formation of complex molecular structures with diverse applications. Additionally, 7-Ethoxy-2-oxo-2H-chromene-3-carboxylic acid plays a crucial role in the development of new materials and is used in the construction of novel chemical entities with potential industrial applications. By incorporating this compound into synthetic routes, chemists can access a myriad of products with tailored properties and functionalities, making it a valuable tool in modern organic synthesis.