
Catalog Number	AR008MQY
Chemical Name	3-Oxo-2，3-dihydro-1H-indazole-5-carboxylic acid
CAS Number	787580-93-2
Molecular Formula	C8H6N2O3
Molecular Weight	178.1448
MDL Number	MFCD07781586
SMILES	OC(=O)c1ccc2c(c1)c(O)n[nH]2

The 3-Oxo-2,3-dihydro-1H-indazole-5-carboxylic acid is a versatile compound widely used in chemical synthesis. Its unique structure and functional groups make it a valuable building block for the creation of various organic molecules. In particular, this compound serves as a key intermediate in the synthesis of pharmaceutical compounds and agrochemicals. Its reactivity allows for the introduction of diverse substituents, enabling the formation of structurally complex and biologically active compounds. Additionally, the presence of a keto group in its structure provides opportunities for further derivatization, expanding its utility in organic synthesis. Due to its importance in the preparation of novel compounds, 3-Oxo-2,3-dihydro-1H-indazole-5-carboxylic acid plays a crucial role in modern chemical research and development.