
Catalog Number	AR01BHXL
Chemical Name	sodium 5-hydroxy-2-propylpentanoate
CAS Number	78644-53-8
Molecular Formula	C8H15NaO3
Molecular Weight	182.1927
MDL Number	MFCD05864848
SMILES	CCCC(C(=O)[O-])CCCO.[Na+]

5-Hydroxy valproic acid sodium salt is a valuable intermediate in chemical synthesis, particularly in the pharmaceutical industry. This compound serves as a key building block for the synthesis of various pharmaceutical agents and drug candidates. With its unique chemical properties, 5-Hydroxy valproic acid sodium salt can be utilized in the creation of novel compounds and the modification of existing drug molecules. Its presence in the chemical synthesis process enables the efficient production of pharmaceuticals with enhanced biological activities and potentially improved therapeutic effects. Additionally, the versatile nature of this compound makes it a versatile tool for researchers and chemists engaged in drug development and medicinal chemistry endeavors.