
Catalog Number	AR00G56O
Chemical Name	3-Methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-5-sulfonyl chloride
CAS Number	78633-42-8
Molecular Formula	C8H6ClNO4S
Molecular Weight	247.6555
MDL Number	MFCD17226538
SMILES	Cn1c(=O)oc2c1cc(cc2)S(=O)(=O)Cl

2,3-Dihydro-3-methyl-2-oxo-5-benzoxazolesulfonyl chloride is a versatile compound widely used in chemical synthesis. This compound serves as a key intermediate in the preparation of various organic molecules, particularly in the pharmaceutical industry. Its unique chemical properties make it a valuable building block for the formation of complex molecular structures.In chemical synthesis, 2,3-Dihydro-3-methyl-2-oxo-5-benzoxazolesulfonyl chloride is commonly employed as a reagent for the introduction of sulfonyl chloride groups into organic molecules. This functional group provides a handle for further derivatization, allowing chemists to create new compounds with enhanced biological or physical properties. Additionally, the sulfonyl chloride moiety can participate in a variety of chemical reactions, such as nucleophilic substitution and condensation reactions, making it a versatile tool in synthetic organic chemistry.Overall, the application of 2,3-Dihydro-3-methyl-2-oxo-5-benzoxazolesulfonyl chloride in chemical synthesis enables the efficient and selective preparation of diverse molecules with potential applications in drug discovery, materials science, and other fields of research.