
Catalog Number	AR0059JB
Chemical Name	(2R,3R,4S,5S,6R)-2-(Heptyloxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol
CAS Number	78617-12-6
Molecular Formula	C13H26O6
Molecular Weight	278.3419
MDL Number	MFCD00063299
SMILES	CCCCCCCO[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O

The compound (2R,3R,4S,5S,6R)-2-(Heptyloxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol serves as a valuable chiral building block in chemical synthesis. Its unique stereochemistry and functional groups make it particularly useful in the construction of complex organic molecules with specific spatial arrangements. This compound can be employed as a key intermediate for the synthesis of various bioactive compounds, pharmaceuticals, and natural products. Additionally, its hydroxyl and alkoxy groups enable further derivatization through various chemical reactions, allowing for the customization of its properties to suit specific synthesis requirements.