
Catalog Number	AR003D7V
Chemical Name	(S)-1，1，1-Trifluoro-N-(pyrrolidin-2-ylmethyl)methanesulfonamide
CAS Number	782495-18-5
Molecular Formula	C6H11F3N2O2S
Molecular Weight	232.22394959999997
MDL Number	MFCD11656045
SMILES	O=S(=O)(C(F)(F)F)NC[C@@H]1CCCN1

The (S)-1,1,1-Trifluoro-N-(pyrrolidin-2-ylmethyl)methanesulfonamide compound is a valuable reagent in chemical synthesis due to its unique properties. It serves as a chiral building block that imparts specific stereochemical characteristics to the molecules it is incorporated into. This compound is commonly used in asymmetric synthesis processes, where the precise control of stereochemistry is crucial in producing optically pure products. By utilizing (S)-1,1,1-Trifluoro-N-(pyrrolidin-2-ylmethyl)methanesulfonamide, chemists can introduce chirality into their target molecules with high selectivity, making it a versatile tool in the development of pharmaceuticals, agrochemicals, and other fine chemicals.