
Catalog Number	AR005EEL
Chemical Name	(R)-3-Amino-3-(2-methoxyphenyl)propanoic acid
CAS Number	780034-13-1
Molecular Formula	C10H13NO3
Molecular Weight	195.2151
MDL Number	MFCD04113645
SMILES	COc1ccccc1[C@@H](CC(=O)O)N

(R)-3-Amino-3-(2-methoxyphenyl)propanoic acid is a valuable compound widely utilized in chemical synthesis as a chiral building block. Its asymmetric structure and unique properties make it an essential component in the creation of pharmaceuticals, agrochemicals, and fine chemicals. The presence of both an amino group and a methoxyphenyl group offers versatile reactivity and enables the selective formation of various derivatives through functional group transformations. In organic synthesis, this compound serves as a key intermediate for the preparation of peptidomimetics, which are vital in drug design and development. The chirality of (R)-3-Amino-3-(2-methoxyphenyl)propanoic acid plays a crucial role in enhancing the stereochemical purity and biological activity of the synthesized molecules, making it a cornerstone in the construction of complex molecular architectures with precise spatial arrangements.