
Catalog Number	AR00GG86
Chemical Name	p-Cresyl diphenyl phosphate.
CAS Number	78-31-9
Molecular Formula	C19H17O4P
Molecular Weight	340.3096
MDL Number	MFCD00152361
SMILES	Cc1ccc(cc1)OP(=O)(Oc1ccccc1)Oc1ccccc1

Diphenyl p-tolyl phosphate is a versatile compound commonly used in chemical synthesis. It serves as a phosphorus-containing reagent, playing a crucial role in various reactions due to its unique chemical properties. In organic synthesis, Diphenyl p-tolyl phosphate is frequently utilized as a phosphitylating agent to introduce phosphorus functionalities into organic molecules. This compound is particularly valuable in the production of phosphorus-containing intermediates for the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, Diphenyl p-tolyl phosphate can participate in phosphorylation reactions, serving as a phosphorylating agent to modify biomolecules and organic substrates. Its ability to facilitate selective phosphorylation reactions makes it a valuable tool in synthetic organic chemistry for the creation of new compounds with tailored properties. The application of Diphenyl p-tolyl phosphate in chemical synthesis extends to the formation of phosphorus-based materials, including polymers and additives, highlighting its significance in modern chemical research and industrial processes.