
Catalog Number	AR00IDLK
Chemical Name	3-(6-Aminopyridin-3-yl)benzoic acid
CAS Number	779315-67-2
Molecular Formula	C12H10N2O2
Molecular Weight	214.22
MDL Number	MFCD06802729
SMILES	Nc1ccc(cn1)c1cccc(c1)C(=O)O

3-(6-Aminopyridin-3-yl)benzoic acid is a versatile compound often employed in chemical synthesis for its unique properties and reactivity. This compound serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and materials due to its functional groups and structural flexibility. In chemical synthesis, 3-(6-Aminopyridin-3-yl)benzoic acid can be utilized as a key intermediate in the production of specialized organic molecules, allowing for the selective modification of its aromatic ring and amino group to generate diverse molecular structures. Additionally, its compatibility with various reaction conditions makes it a useful tool in the construction of complex chemical frameworks, enabling the development of novel compounds with tailored properties and functionalities. By incorporating 3-(6-Aminopyridin-3-yl)benzoic acid into synthetic pathways, chemists can access a wide range of potential applications in the fields of drug discovery, materials science, and chemical research.