
Catalog Number	AR00587P
Chemical Name	N-(3-METHYL-1-ADAMANTYL)ACETAMIDE
CAS Number	778-09-6
Molecular Formula	C13H21NO
Molecular Weight	207.3119
SMILES	CC(=O)NC12CC3CC(C1)CC(C2)(C3)C
NSC Number	179381

N-(3-Methyl-1-adamantyl)acetamide is a versatile compound used in various chemical synthesis applications. It serves as a crucial building block in the development of organic molecules and pharmaceutical compounds. The unique structure of N-(3-Methyl-1-adamantyl)acetamide makes it an ideal reagent for introducing specific functional groups or modifying existing chemical structures. This compound's high reactivity and stability make it a valuable tool for organic chemists seeking to create complex molecules with precision. In chemical synthesis, N-(3-Methyl-1-adamantyl)acetamide plays a pivotal role in the creation of novel materials, drug candidates, and other fine chemicals. Its use extends to a wide range of industries, including pharmaceuticals, agrochemicals, and materials science, where its versatile nature and diverse applications continue to drive innovation and research efforts.