
Catalog Number	AR005GQI
Chemical Name	2-(3,5-DIMETHYLPHENOXY)PROPANOIC ACID
CAS Number	777-57-1
Molecular Formula	C11H14O3
Molecular Weight	194.2271
MDL Number	MFCD03422220
SMILES	CC(C(=O)O)Oc1cc(C)cc(c1)C

2-(3,5-Dimethylphenoxy)propanoic acid is a highly versatile compound commonly utilized in chemical synthesis processes. This compound serves as a crucial building block in the creation of various pharmaceuticals, agricultural chemicals, and agrochemicals. Its unique molecular structure enables it to be easily incorporated into organic reactions, making it a valuable intermediate in the production of complex molecules. Additionally, 2-(3,5-Dimethylphenoxy)propanoic acid exhibits excellent reactivity and compatibility with a wide range of other reagents, allowing for efficient and precise transformations in synthetic routes. Its utility in chemical synthesis extends to the creation of specialized materials and research purposes, highlighting its significance in the field of chemistry.