
Catalog Number	AR00G52J
Chemical Name	Protopanaxadiol
CAS Number	7755-01-3
Molecular Formula	C30H52O3
Molecular Weight	460.7321
MDL Number	MFCD13194757
SMILES	CC(=CCC[C@]([C@H]1CC[C@]2([C@@H]1[C@H](O)C[C@H]1[C@@]2(C)CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)(O)C)C

(20R)-Protopanaxdiol is a versatile compound widely utilized in chemical synthesis due to its unique structural and functional properties. This natural product, derived from ginseng plants, serves as a valuable building block in the creation of various complex molecules and pharmaceuticals.In chemical synthesis, (20R)-Protopanaxdiol can undergo numerous transformative reactions to generate structurally diverse compounds. Its hydroxyl groups enable the introduction of different functional groups, allowing for the modification of its chemical properties. This compound serves as an intermediate in the synthesis of bioactive compounds and drug candidates, playing a crucial role in the development of new pharmaceutical agents.Furthermore, the stereochemistry of (20R)-Protopanaxdiol is essential in determining the stereochemical outcomes of subsequent reactions, making it an indispensable tool in asymmetric synthesis. Chemists often leverage the specific configuration of this molecule to control the stereochemistry of their target molecules, ensuring the desired biological activity and pharmacological properties.Overall, (20R)-Protopanaxdiol is a valuable component in chemical synthesis, offering a pathway to access diverse chemical space and develop innovative compounds with potential therapeutic applications. Its versatility and reactivity make it a key player in the realm of organic chemistry and drug discovery.