
Catalog Number	AR005C9C
Chemical Name	methyl 5-bromo-2-(trifluoromethoxy)benzoate
CAS Number	773874-13-8
Molecular Formula	C9H6BrF3O3
Molecular Weight	299.0413
MDL Number	MFCD06203799
SMILES	COC(=O)c1cc(Br)ccc1OC(F)(F)F

Methyl 5-bromo-2-(trifluoromethoxy)benzoate serves as a versatile building block in chemical synthesis processes. This compound is commonly utilized as a key intermediate in the production of various pharmaceuticals, agrochemicals, and advanced materials. Its unique structure imparts valuable reactivity and functionality, allowing for efficient derivatization and incorporation into intricate molecular frameworks. Through strategic manipulation of its reactive sites, chemists can access a diverse array of substituted benzene derivatives, heterocyclic compounds, and complex organic molecules. The presence of the bromo and trifluoromethoxy groups enables precise control over the regioselectivity and stereoselectivity of subsequent reactions, facilitating the creation of structurally complex and stereochemically defined products. Whether employed in the synthesis of bioactive compounds, functional materials, or molecular probes, Methyl 5-bromo-2-(trifluoromethoxy)benzoate remains an indispensable tool for modern chemical research and development.