
Catalog Number	AR00G357
Chemical Name	(3'-TRIFLUOROMETHYLBIPHENYL-3-YL)-METHANOL
CAS Number	773872-61-0
Molecular Formula	C14H11F3O
Molecular Weight	252.2317
MDL Number	MFCD05980218
SMILES	OCc1cccc(c1)c1cccc(c1)C(F)(F)F

The product, (3'-(Trifluoromethyl)-[1,1'-biphenyl]-3-yl)methanol, plays a crucial role in chemical synthesis as a versatile building block. Its unique structure, incorporating a trifluoromethyl group and a biphenyl moiety, offers a wide range of applications in organic chemistry. This compound can serve as a valuable starting material for the synthesis of various complex molecules, enabling the introduction of the trifluoromethyl functionality into target compounds. Additionally, the biphenyl scaffold provides rigidity and structural diversity, making it an attractive moiety for the design and synthesis of new materials, pharmaceuticals, and agrochemicals. The (3'-(Trifluoromethyl)-[1,1'-biphenyl]-3-yl)methanol is an indispensable tool for chemists seeking to explore novel synthetic strategies and develop innovative molecules with enhanced properties and functionalities.