
Catalog Number	AR00GRVU
Chemical Name	tert-Butyl 4-(3-aminopropoxy)piperidine-1-carboxylate
CAS Number	771572-33-9
Molecular Formula	C13H26N2O3
Molecular Weight	258.3571
MDL Number	MFCD06213536
SMILES	NCCCOC1CCN(CC1)C(=O)OC(C)(C)C

The tert-Butyl 4-(3-aminopropoxy)piperidine-1-carboxylate is a versatile compound used in chemical synthesis for its unique properties. It acts as a key building block in the creation of complex organic molecules and pharmaceuticals due to its functional groups and reactivity. This compound is particularly valuable in the development of novel drug candidates, where its specific structure allows for precise modifications and control over the synthesis process. By incorporating tert-Butyl 4-(3-aminopropoxy)piperidine-1-carboxylate into synthetic pathways, chemists can effectively introduce the desired functionalities and structural elements needed to target specific biological activities or improve the pharmacokinetic properties of a compound. Its application in chemical synthesis offers researchers a strategic tool for designing and producing a wide range of advanced molecular structures with potential therapeutic benefits.