
Catalog Number	AR005FXS
Chemical Name	4-Nitrophenyl β-D-N,N',N''-triacetylchitotriose
CAS Number	7699-38-9
Molecular Formula	C30H44N4O18
Molecular Weight	748.6864
MDL Number	MFCD00057914
SMILES	OCC1OC(Oc2ccc(cc2)[N+](=O)[O-])C(C(C1OC1OC(CO)C(C(C1NC(=O)C)O)OC1OC(CO)C(C(C1NC(=O)C)O)O)O)NC(=O)C

4-Nitrophenyl β-D-N,N',N''-triacetylchitotriose, a versatile compound in chemical synthesis, is commonly utilized as a derivatizing agent and building block in organic chemistry. Its unique structure and reactivity make it a valuable tool for modifying and functionalizing various molecules, particularly in the synthesis of complex carbohydrates and chitin derivatives. With its ability to selectively react with specific functional groups, this compound plays a crucial role in the efficient construction of intricate chemical structures. In addition, the 4-Nitrophenyl β-D-N,N',N''-triacetylchitotriose is instrumental in the development of novel materials and pharmaceuticals, showcasing its significance in advancing synthetic chemistry research.