
Catalog Number	AR005GTI
Chemical Name	1-Boc-2'-oxo-2',4'-dihydro-1'H-spiro[piperidine-4,3'-quinoline]
CAS Number	769106-43-6
Molecular Formula	C18H24N2O3
Molecular Weight	316.3948
MDL Number	MFCD12198638
SMILES	O=C(N1CCC2(CC1)Cc1ccccc1NC2=O)OC(C)(C)C

1-Boc-2'-oxo-2',4'-dihydro-1'H-spiro[piperidine-4,3'-quinoline] is a versatile compound commonly used in chemical synthesis for its unique structural features and functional properties. Its spirocyclic structure provides rigidity and stereochemical control, making it a valuable building block in the creation of complex organic molecules.In chemical synthesis, 1-Boc-2'-oxo-2',4'-dihydro-1'H-spiro[piperidine-4,3'-quinoline] can serve as a key intermediate for the synthesis of various biologically active compounds, pharmaceuticals, and natural products. Its structural motifs allow for selective functionalization at different positions, enabling chemists to tailor the molecule for specific applications.Furthermore, the presence of a Boc (tert-butoxycarbonyl) protecting group provides stability during chemical transformations and allows for controlled deprotection under mild conditions, making the compound particularly useful in sequential reactions.Overall, the strategic incorporation of 1-Boc-2'-oxo-2',4'-dihydro-1'H-spiro[piperidine-4,3'-quinoline] in chemical synthesis offers chemists a powerful tool for the efficient construction of diverse molecular architectures with precise stereochemical control and functional group tolerance.