
Catalog Number	AR00IDGP
Chemical Name	BENZENEPROPANOIC ACID, A,3,4-TRIHYDROXY-, (AR)-
CAS Number	76822-21-4
Molecular Formula	C9H10O5
Molecular Weight	198.1727
MDL Number	MFCD09750417
SMILES	OC(=O)[C@@H](Cc1ccc(c(c1)O)O)O

The (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid is a versatile compound that finds wide applications in chemical synthesis. This compound is commonly used as a chiral building block in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. Its chiral nature, derived from the specific configuration at the 2nd carbon atom, imparts unique properties that are crucial for asymmetric synthesis, where the control of stereochemistry is essential.In chemical synthesis, (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid serves as a key intermediate for the preparation of chiral molecules with biological activity. Its presence in the molecular structure can influence the pharmacological properties of the final compound, making it a valuable tool in drug discovery and development processes. Additionally, this compound can participate in various reactions such as esterification, amidation, oxidation, and reduction, providing a diverse array of synthetic pathways for the creation of complex molecules.Moreover, the (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid can act as a ligand in metal-catalyzed reactions, enabling efficient and selective transformations in organic synthesis. Its ability to coordinate with transition metals allows for the development of catalytic systems that facilitate challenging bond-forming processes with high levels of enantioselectivity.Overall, the (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid plays a crucial role in chemical synthesis by providing a valuable starting material for the construction of structurally complex and biologically relevant molecules. Its versatility and chiral properties make it a sought-after compound in the field of organic chemistry, serving as a fundamental building block for the creation of new chemical entities with tailored properties.