
Catalog Number	AR008Q2F
Chemical Name	GBR 12935
CAS Number	76778-22-8
Molecular Formula	C32H38N2O5
Molecular Weight	530.6545
MDL Number	MFCD22199557
SMILES	c1ccc(cc1)CCCN1CCN(CC1)CCOC(c1ccccc1)c1ccccc1.OC(=O)/C=CC(=O)O

GBR 12935, a potent selective dopamine reuptake inhibitor, is widely utilized in chemical synthesis for its unique properties in facilitating the production of various pharmaceutical compounds. Thanks to its specific interactions with dopamine transporters, GBR 12935 plays a crucial role in the creation of dopamine-related drug candidates, thereby enabling researchers to explore novel treatment options for neurological disorders and other conditions. Furthermore, its high purity and consistent quality make it a valuable tool in the development of innovative drug formulations with enhanced efficacy and safety profiles. In the realm of chemical synthesis, GBR 12935 serves as a valuable building block for the creation of new therapeutic agents, underscoring its significance in driving advancements in pharmaceutical research and development.