
Catalog Number	AR00GACD
Chemical Name	Sch 40458
CAS Number	76639-93-5
Molecular Formula	C10H14FNO3S
Molecular Weight	247.2864632
MDL Number	MFCD19704818
SMILES	FC[C@H]([C@@H](c1ccc(cc1)S(=O)(=O)C)O)N

Florfenicol amine, a derivative of the antibiotic florfenicol, is a versatile compound widely used in chemical synthesis. Its application in organic chemistry is particularly noteworthy due to its ability to serve as a key building block in the production of various pharmaceuticals and agrochemicals. Florfenicol amine's unique chemical structure allows for diverse functional group manipulations, making it a valuable intermediate in the synthesis of complex molecules. Chemists leverage its reactivity and selectivity to introduce specific functionalities or structural motifs into target compounds, facilitating the development of new drugs, pesticides, and other bioactive molecules. This compound plays a pivotal role in the strategic design and construction of molecular frameworks, offering synthetic chemists the opportunity to explore innovative synthetic routes and enhance the efficiency of their synthetic transformations.