
Catalog Number	AR00G37D
Chemical Name	3,5-Dinitrocatechol
CAS Number	7659-29-2
Molecular Formula	C6H4N2O6
Molecular Weight	200.1058
MDL Number	MFCD00069263
SMILES	[O-][N+](=O)c1cc(O)c(c(c1)[N+](=O)[O-])O

3,5-Dinitrocatechol, a compound featuring two nitro groups on a catechol ring, is a key player in chemical synthesis due to its versatile applications. In organic chemistry, this compound is predominantly used as a building block in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure allows for the introduction of functional groups at specific positions, enabling chemists to tailor the molecular properties of the final products. Furthermore, 3,5-Dinitrocatechol serves as a vital intermediate in the production of dyes, pigments, and antioxidants, showcasing its importance in the manufacturing industry. Its ability to undergo selective reactions and form intricate molecular structures makes it a valuable tool for researchers and professionals working in the field of synthetic chemistry.