
Catalog Number	AR005D0H
Chemical Name	Z-L-Thr-OSu
CAS Number	76401-90-6
Molecular Formula	C16H18N2O7
Molecular Weight	350.3233
MDL Number	MFCD00153344
SMILES	C[C@H]([C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OCc1ccccc1)O

The compound (2S,3R)-2,5-Dioxopyrrolidin-1-yl 2-(((benzyloxy)carbonyl)amino)-3-hydroxybutanoate, commonly referred to as $name$, serves as a valuable intermediate in chemical synthesis processes. Its application lies in its ability to function as a versatile building block for the synthesis of complex organic molecules. When utilized in chemical reactions, $name$ plays a crucial role in the formation of peptide bonds and the creation of structurally intricate compounds. This compound's unique structure and reactivity make it a key component in the strategic design and assembly of various pharmaceuticals, agrochemicals, and materials in the realm of organic synthesis.