
Catalog Number	AR00G3SL
Chemical Name	L-Homocysteine, S-(trifluoromethyl)-
CAS Number	764-52-3
Molecular Formula	C5H8F3NO2S
Molecular Weight	203.1827
MDL Number	MFCD07636752
SMILES	OC(=O)[C@H](CCSC(F)(F)F)N

The application of S-(Trifluoromethyl)-L-homocysteine in chemical synthesis lies in its potential as a versatile building block for the development of various pharmaceuticals, agrochemicals, and specialty chemicals. As a unique amino acid derivative, S-(Trifluoromethyl)-L-homocysteine offers a strategic entry point for introducing the trifluoromethyl (CF3) functional group into target molecules. This CF3 group is highly valuable in medicinal chemistry due to its ability to enhance the physicochemical properties and biological activities of organic compounds. By incorporating S-(Trifluoromethyl)-L-homocysteine into synthetic routes, chemists can access novel CF3-containing structures that exhibit improved pharmacokinetic profiles, metabolic stability, and interaction with biological targets. Furthermore, the presence of the homocysteine backbone in this building block offers additional opportunities for structural modifications, enabling the design and synthesis of diverse chemical entities with tailored properties for specific applications. Overall, the strategic use of S-(Trifluoromethyl)-L-homocysteine in chemical synthesis enables the efficient construction of complex molecules with enhanced biological potential and is instrumental in advancing drug discovery and development efforts.