
Catalog Number	AR00G4SZ
Chemical Name	Chonglou Saponin II
CAS Number	76296-72-5
Molecular Formula	C44H70O16
Molecular Weight	855.017
MDL Number	MFCD13195305
SMILES	OCC1OC(OC2CCC3(C(=CCC4C3CCC3(C4CC4C3C(C)C3(O4)CCC(CO3)C)C)C2)C)C(C(C1OC1OC(C(C1O)O)CO)OC1OC(C)C(C(C1O)O)O)O

Polyphyllin D is a natural compound that has shown significant potential in chemical synthesis applications. Its unique structure and properties make it a valuable tool in the development of new organic compounds and pharmaceuticals. In chemical synthesis, Polyphyllin D can act as a versatile building block for creating complex molecular structures due to its multiple reactive sites. This compound's ability to undergo various chemical transformations allows for the creation of diverse chemical entities with potential biological activities. Researchers utilize Polyphyllin D in the synthesis of novel drug candidates, natural product derivatives, and other bioactive molecules, further highlighting its importance in the field of organic chemistry.