
Catalog Number	AR00G339
Chemical Name	8-Benzyl-3α-amino-1αH,5αH-nortropane
CAS Number	76272-35-0
Molecular Formula	C14H20N2
Molecular Weight	216.322
MDL Number	MFCD08460051
SMILES	NC1C[C@@H]2CC[C@H](C1)N2Cc1ccccc1

(3-endo)-8-(Phenylmethyl)-8-azabicyclo[3.2.1]octan-3-amine, a versatile compound in chemical synthesis, plays a crucial role in various reactions. Its unique structure and properties make it a valuable reagent for several key transformations. When used in chemical synthesis, this compound acts as a vital building block for the creation of complex organic molecules. It serves as a scaffold for constructing diverse molecular architectures due to its specific stereochemistry and functional groups. Additionally, (3-endo)-8-(Phenylmethyl)-8-azabicyclo[3.2.1]octan-3-amine facilitates the formation of new bonds and enables the development of novel compounds with potential applications in pharmaceuticals, materials science, and other fields requiring tailored molecular structures. This compound's ability to participate in strategic bond-forming reactions makes it an indispensable tool for organic chemists seeking to design and synthesize advanced molecules with precise control over stereochemistry and functionality.