
Catalog Number	AR00G4CQ
Chemical Name	2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methylbenzenesulfonamide
CAS Number	761440-11-3
Molecular Formula	C11H10Cl2N4O2S
Molecular Weight	333.1937
MDL Number	MFCD26398788
SMILES	CNS(=O)(=O)c1ccccc1Nc1nc(Cl)ncc1Cl

2-[(2,5-Dichloropyrimidin-4-yl)amino]-N-methylbenzenesulfonamide, a versatile compound in chemical synthesis, serves as a key building block in the creation of novel pharmaceuticals, agrochemicals, and materials. Its strategic placement of functional groups allows for precise modifications and additions, enabling synthetic chemists to tailor its structure to suit specific applications. In organic synthesis, this compound plays a crucial role as a reagent for introducing the unique functionalities of the pyrimidine and sulfonamide moieties into target molecules, facilitating the development of diverse chemical structures with enhanced biological or material properties. The presence of the N-methyl group enhances the compound's stability and solubility, making it a valuable asset in designing advanced synthetic pathways and methodologies for the synthesis of complex molecules.