
Catalog Number	AR00G4F1
Chemical Name	Teneligliptin
CAS Number	760937-92-6
Molecular Formula	C22H30N6OS
Molecular Weight	426.5782
MDL Number	MFCD13195565
SMILES	O=C(N1CSCC1)[C@H]1NC[C@H](C1)N1CCN(CC1)c1cc(nn1c1ccccc1)C

Teneligliptin, a commonly used pharmaceutical compound, serves a crucial role in chemical synthesis as a potent dipeptidyl peptidase-4 inhibitor. In organic chemistry, this compound finds extensive application in the development of novel molecules and drug candidates. By inhibiting the DPP-4 enzyme, Teneligliptin plays a pivotal role in modulating glucose metabolism and insulin secretion, making it a promising candidate for the treatment of type 2 diabetes mellitus.Moreover, Teneligliptin's unique molecular structure allows for diverse synthetic routes and functional group manipulations, making it a versatile building block in organic synthesis. Its pharmacological properties and established biological activity make it a valuable tool in the design and synthesis of new pharmaceutical agents.Overall, the strategic use of Teneligliptin in chemical synthesis not only enables the construction of complex molecular structures but also holds significant promise in the development of therapeutic agents with enhanced efficacy and safety profiles.