
Catalog Number	AR00G3BN
Chemical Name	ETHYL 2-CHLORO-5-CYANO-6-METHYLNICOTINATE
CAS Number	75894-43-8
Molecular Formula	C10H9ClN2O2
Molecular Weight	224.6437
MDL Number	MFCD01565859
SMILES	CCOC(=O)c1cc(C#N)c(nc1Cl)C

Ethyl 2-chloro-5-cyano-6-methylnicotinate is a versatile compound widely utilized in chemical synthesis due to its unique reactivity and functional group compatibility. In the realm of organic chemistry, this compound serves as a valuable building block for the creation of complex molecular structures through various synthetic pathways. One of the key applications of Ethyl 2-chloro-5-cyano-6-methylnicotinate lies in its ability to participate in diverse reactions such as nucleophilic substitution, esterification, and cyclization.This compound can be employed as a precursor in the synthesis of pharmacologically active molecules, agrochemicals, and functional materials. Its strategic placement of a chloro, cyano, and methyl group on the nicotinate scaffold offers opportunities for further functionalization and modification, enabling the design and production of novel compounds with tailored properties and enhanced activities. Additionally, the presence of the ethyl ester group provides a handle for manipulation and derivatization, allowing for the introduction of additional functionalities or structural motifs to fine-tune the desired properties of the final products.