
Catalog Number	AR005AJQ
Chemical Name	Pregn-4-en-21-oic acid,11,20-dihydroxy-3-oxo-, (11b)-
CAS Number	75879-79-7
Molecular Formula	C21H30O5
Molecular Weight	362.4599
SMILES	O=C1CC[C@]2(C(=C1)CC[C@@H]1[C@@H]2C(O)C[C@]2([C@H]1CC[C@@H]2C(C(=O)O)O)C)C

Pregn-4-en-21-oic acid, 11,20-dihydroxy-3-oxo-, (11β)- is a versatile compound commonly utilized in chemical synthesis for its potent biological properties. With its unique structure and functional groups, this compound serves as a key intermediate in the synthesis of various pharmaceuticals, steroids, and hormones. In organic chemistry, it is frequently employed as a precursor for the preparation of synthetic analogs with enhanced therapeutic activities. Its involvement in the synthesis of novel drug candidates highlights its significance in medicinal chemistry research. This compound plays a crucial role in the development of new molecules for pharmaceutical applications, demonstrating its value as a building block in chemical synthesis strategies. Its reactivity and structural features make it a valuable tool for chemists seeking to design and create complex molecular structures with targeted biological activities.