
Catalog Number	AR01CMQS
Chemical Name	Ethenesulfonamide,N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-
CAS Number	756520-45-3
Molecular Formula	C14H20BNO4S
Molecular Weight	309.1889
MDL Number	MFCD22494224
SMILES	C=CS(=O)(=O)Nc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethenesulfonamide is a versatile compound commonly utilized in chemical synthesis as a highly selective and efficient reagent for the introduction of boronic acid functionality into organic molecules. This compound is particularly valuable in Suzuki-Miyaura cross-coupling reactions, where it serves as a key component for the construction of C-C bonds in the synthesis of various biaryl compounds. Additionally, N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethenesulfonamide displays excellent reactivity and stability under a wide range of reaction conditions, making it a valuable tool for the efficient preparation of complex organic molecules in the laboratory.