
Catalog Number	AR005K6P
Chemical Name	(R)-1-(1H-Imidazol-4-yl)propan-2-amine dihydrochloride
CAS Number	75614-89-0
Molecular Formula	C6H13Cl2N3
Molecular Weight	198.0935
MDL Number	MFCD00083176
SMILES	C[C@H](Cc1c[nH]cn1)N.Cl.Cl

(R)-1-(1H-Imidazol-4-yl)propan-2-amine dihydrochloride is a valuable compound widely utilized in chemical synthesis due to its unique properties and versatile applications. In organic chemistry, this compound serves as a key building block for the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals.Due to its chiral nature, (R)-1-(1H-Imidazol-4-yl)propan-2-amine dihydrochloride is often employed in asymmetric synthesis to produce enantiomerically pure compounds. This compound can participate in a variety of reactions such as reductive amination, cross-coupling reactions, and nucleophilic substitutions, enabling the creation of complex molecules with high stereochemical control.Additionally, (R)-1-(1H-Imidazol-4-yl)propan-2-amine dihydrochloride can be used as a ligand in transition metal-catalyzed reactions, facilitating selective bond formations and enhancing reaction efficiency. Its ability to modulate the reactivity and selectivity of metal catalysts makes it a valuable tool in modern synthetic chemistry.Overall, the application of (R)-1-(1H-Imidazol-4-yl)propan-2-amine dihydrochloride in chemical synthesis enables the efficient and precise construction of diverse organic molecules, making it an essential compound in the toolkit of synthetic chemists.