
Catalog Number	AR00GGBQ
Chemical Name	[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy-[hydroxy-[3-hydroxy-2,2-dimethyl-3-[2-[2-(2-phenylacetyl)sulfanylethylcarbamoyl]ethylcarbamoyl]propoxy]phosphoryl]oxy-phosphoryl]oxymethyl]oxolan-3-yl]oxyphosphonic acid
CAS Number	7532-39-0
Molecular Formula	C29H42N7O17P3S
Molecular Weight	885.6668
SMILES	O=C(NCCSC(=O)Cc1ccccc1)CCNC(=O)[C@@H](C(COP(=O)(OP(=O)(OC[C@H]1O[C@H]([C@@H]([C@@H]1OP(=O)(O)O)O)n1cnc2c1ncnc2N)O)O)(C)C)O

Phenylacetyl CoA serves as a crucial intermediate in various chemical synthesis processes, particularly in the biosynthesis of specific natural products and pharmaceutical compounds. Through its involvement in the phenylpropanoid pathway, Phenylacetyl CoA contributes to the production of a wide range of secondary metabolites in plants, such as flavonoids, lignans, and stilbenes.In pharmaceutical chemistry, Phenylacetyl CoA plays a vital role in the biosynthesis of certain antibiotics and antitumor agents. Its ability to act as a precursor in the synthesis of structurally complex molecules makes it an essential building block for creating bioactive compounds with therapeutic potential.Furthermore, the versatility of Phenylacetyl CoA in chemical synthesis extends to the creation of artificial flavors and fragrances. By utilizing this intermediate, chemists can design and produce aromatic compounds that mimic the scents and tastes found in nature, catering to various industries such as food, cosmetics, and perfumery.