
Catalog Number	AR005DAZ
Chemical Name	Methylphosphonic Acid Diphenyl Ester
CAS Number	7526-26-3
Molecular Formula	C13H13O3P
Molecular Weight	248.2143
MDL Number	MFCD00137951
SMILES	CP(=O)(Oc1ccccc1)Oc1ccccc1

Diphenyl methylphosphonate is a versatile organophosphorus compound widely used in chemical synthesis as a key reagent. Its applications are diverse, ranging from pharmaceuticals and agrochemicals to materials science and polymer chemistry. In chemical synthesis, Diphenyl methylphosphonate serves as a valuable precursor for the preparation of various organophosphorus compounds. Its ability to undergo substitution reactions enables the introduction of the phosphonate functional group into the target molecule, thus providing access to a wide range of phosphorus-containing compounds with useful properties. Additionally, Diphenyl methylphosphonate can act as a phosphorus source in reactions involving nucleophilic phosphorus transfer, making it an essential tool in the synthesis of phosphorus-containing heterocycles and compounds with potential biological activity. Its role in the construction of phosphorus-carbon bonds further highlights its significance in the field of chemical synthesis, offering chemists a reliable method for the efficient preparation of complex organophosphorus compounds.