
Catalog Number	AR003OE3
Chemical Name	Albendazole sulfone
CAS Number	75184-71-3
Molecular Formula	C12H15N3O4S
Molecular Weight	297.3302
MDL Number	MFCD00600775
SMILES	CCCS(=O)(=O)c1ccc2c(c1)nc([nH]2)NC(=O)OC

Carbamic acid, N-[6-(propylsulfonyl)-1H-benzimidazol-2-yl]-, methyl ester is a versatile compound widely utilized in chemical synthesis. Its unique structure and properties make it a valuable building block in the development of various organic compounds. In chemical synthesis, this compound serves as a key intermediate in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals. Its reactivity allows for the introduction of functional groups or modifications to existing molecules, enabling the creation of new and diverse chemical entities. Additionally, its use in asymmetric synthesis methods has led to the development of chiral compounds with high enantiomeric purity, making it an important tool in the production of optically pure substances.