
Catalog Number	AR00G82R
Chemical Name	1,2-O-Isopropylidene-5-O-(4-Methylbenzoyl)-alpha-D-xylofuranose
CAS Number	75096-60-5
Molecular Formula	C16H20O6
Molecular Weight	308.3264
MDL Number	MFCD22666282
SMILES	Cc1ccc(cc1)C(=O)OC[C@H]1O[C@H]2[C@@H]([C@H]1O)OC(O2)(C)C

The compound ((3aR,5R,6S,6aR)-6-Hydroxy-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl 4-methylbenzoate can be utilized in chemical synthesis as a versatile building block due to its unique structural features. Its hydroxy and methylbenzoate groups make it a valuable intermediate in the preparation of various complex organic compounds. In organic synthesis, this compound can serve as a key starting material for the construction of diverse molecular architectures through strategic functional group manipulations and transformations. Its stereochemical configuration and reactive functional groups provide opportunities for creating new chemical entities with tailored properties and functionalities.